CymitQuimica logo

CAS 1408075-77-3

:

Ethyl tetrahydro-5-oxo-2H-pyran-2-carboxylate

Description:
Ethyl tetrahydro-5-oxo-2H-pyran-2-carboxylate, identified by its CAS number 1408075-77-3, is an organic compound characterized by its pyran ring structure, which is a six-membered ring containing one oxygen atom. This compound features a carboxylate functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the ethyl ester group enhances its solubility in organic solvents, making it useful in various chemical reactions. The tetrahydro configuration indicates that the compound is saturated, which typically results in increased stability compared to its unsaturated counterparts. Ethyl tetrahydro-5-oxo-2H-pyran-2-carboxylate may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Its structural features suggest potential applications in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C8H12O4
InChI:InChI=1S/C8H12O4/c1-2-11-8(10)7-4-3-6(9)5-12-7/h7H,2-5H2,1H3
InChI key:InChIKey=LUBZMSYQUPSNNY-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1CCC(=O)CO1
Synonyms:
  • Ethyl tetrahydro-5-oxo-2H-pyran-2-carboxylate
  • 2H-Pyran-2-carboxylic acid, tetrahydro-5-oxo-, ethyl ester
Found 3 products.