CAS 1408076-33-4

1-Piperidinecarboxylic acid, 3-amino-3-methyl-, 1,1-dimethylethyl ester, ethanedioate (1:1)

Description:

1-Piperidinecarboxylic acid, 3-amino-3-methyl-, 1,1-dimethylethyl ester, ethanedioate (1:1), with CAS number 1408076-33-4, is a chemical compound characterized by its complex structure, which includes a piperidine ring and an ester functional group. This compound features a carboxylic acid derivative with an amino group and a tert-butyl ester, contributing to its potential biological activity. The presence of the ethanedioate moiety indicates that it forms a salt or complex with ethanoic acid, which may influence its solubility and stability. Typically, compounds of this nature may exhibit properties such as moderate to high polarity, which can affect their interaction with biological systems. Additionally, the presence of multiple functional groups suggests potential reactivity, making it of interest in medicinal chemistry and drug development. Its specific applications and behavior would depend on further studies, including its synthesis, stability under various conditions, and biological activity.

Formula: C₁₁H₂₂N₂O₂·C₂H₂O₄

InChI: InChI=1S/C11H22N2O2.C2H2O4/c1-10(2,3)15-9(14)13-7-5-6-11(4,12)8-13;3-1(4)2(5)6/h5-8,12H2,1-4H3;(H,3,4)(H,5,6)

InChI key: InChIKey=HDLKVMFZJWOPKE-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC(C)(N)CCC1.C(C(O)=O)(O)=O

Synonyms:

• 1-Piperidinecarboxylic acid, 3-amino-3-methyl-, 1,1-dimethylethyl ester, ethanedioate (1:1)