CAS 140834-55-5
:methyl (4-{2-[(2-hydroxy-3-phenoxypropyl)amino]ethoxy}phenoxy)acetate hydrochloride (1:1)
Description:
Methyl (4-{2-[(2-hydroxy-3-phenoxypropyl)amino]ethoxy}phenoxy)acetate hydrochloride, with the CAS number 140834-55-5, is a synthetic organic compound characterized by its complex structure, which includes multiple functional groups such as esters, amines, and phenolic moieties. This compound typically appears as a white to off-white solid and is soluble in polar solvents like water and alcohols, owing to the presence of hydroxyl and amino groups. Its hydrochloride form indicates that it is a salt, which can enhance its stability and solubility in aqueous environments. The presence of the phenoxy and ethoxy groups suggests potential applications in pharmaceuticals, particularly in drug formulation, due to their ability to interact with biological systems. Additionally, the compound may exhibit specific biological activities, making it of interest in medicinal chemistry. As with many synthetic compounds, handling should be done with care, following appropriate safety protocols to mitigate any potential hazards associated with its use.
Formula:C20H26ClNO6
InChI:InChI=1/C20H25NO6.ClH/c1-24-20(23)15-27-19-9-7-18(8-10-19)25-12-11-21-13-16(22)14-26-17-5-3-2-4-6-17;/h2-10,16,21-22H,11-15H2,1H3;1H
Synonyms:- Acetic acid, (4-(2-((2-hydroxy-3-phenoxypropyl)amino)ethoxy)phenoxy)-, methyl ester hydrochloride, (+-)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
ICI-198157
CAS:<p>ICI-198157 is a selective beta3-adrenergic agonist of brown adipose tissue and thermogenesis in rat.</p>Formula:C20H26ClNO6Color and Shape:SolidMolecular weight:411.88
