
CAS 14087-31-1
:Gaxilose
Description:
Gaxilose, with the CAS number 14087-31-1, is a chemical compound that belongs to the class of carbohydrates, specifically a sugar derivative. It is characterized by its structural composition, which includes a specific arrangement of carbon, hydrogen, and oxygen atoms. Gaxilose is known for its potential applications in various fields, including biochemistry and pharmaceuticals, due to its ability to interact with biological systems. The compound may exhibit properties such as solubility in water, which is typical for many sugars, and it may participate in biochemical pathways as a substrate or inhibitor. Its reactivity can be influenced by functional groups present in its structure, allowing it to engage in glycosidic bond formation or hydrolysis under certain conditions. While specific biological activities and mechanisms of action may vary, research into Gaxilose suggests it could have implications in metabolic studies or therapeutic applications. Further investigation into its properties and effects is essential for understanding its full potential in scientific and industrial contexts.
Formula:C11H20O10
InChI:InChI=1S/C11H20O10/c12-1-4(15)7(16)5(2-13)20-11-10(19)9(18)8(17)6(3-14)21-11/h1,4-11,13-19H,2-3H2/t4-,5+,6+,7+,8-,9-,10+,11+/m0/s1
InChI key:InChIKey=BYZQBCIYLALLPA-NOPGXMAYSA-N
SMILES:O([C@@H]([C@@H]([C@H](C=O)O)O)CO)[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O
Synonyms:- Xylose, 4-O-β-D-galactopyranosyl-, D-
- Gaxilose
- 4-O-β-D-Galactopyranosyl-D-xylose
- D-Xylose, 4-O-β-D-galactopyranosyl-
- 4-O-β-D-Galactosyl-D-xylose
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Gaxilose
CAS:<p>Gaxilose, a synthetic disaccharide for noninvasive lactase activity tests, is hydrolyzed and measured in urine.</p>Formula:C11H20O10Color and Shape:SolidMolecular weight:312.271
