CAS 14088-96-1: 1-(3-Bromophenyl)-2-imidazolidinone

Description:1-(3-Bromophenyl)-2-imidazolidinone, with the CAS number 14088-96-1, is a chemical compound characterized by its imidazolidinone structure, which features a five-membered ring containing two nitrogen atoms. The presence of a bromophenyl group indicates that a bromine atom is substituted on the phenyl ring at the meta position, influencing the compound's reactivity and physical properties. This compound typically exhibits solid-state characteristics at room temperature and may be soluble in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the imidazolidinone moiety, which is often associated with biological activity. Additionally, the bromine substituent can enhance the compound's lipophilicity and may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Overall, 1-(3-Bromophenyl)-2-imidazolidinone is of interest for its potential utility in synthetic organic chemistry and drug development.

Formula:C₉H₉BrN₂O

InChI:InChI=1S/C9H9BrN2O/c10-7-2-1-3-8(6-7)12-5-4-11-9(12)13/h1-3,6H,4-5H2,(H,11,13)

InChI key:InChIKey=YWUYVOVMNCGEQZ-UHFFFAOYSA-N

SMILES:O=C1NCCN1C=2C=CC=C(Br)C2

Synonyms:
1-(3-Bromophenyl)-2-imidazolidinone
1-(3-Bromophenyl)imidazolidin-2-one
2-Imidazolidinone, 1-(3-bromophenyl)-
2-Imidazolidinone, 1-(m-bromophenyl)-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2-Imidazolidinone, 1-(3-bromophenyl)- REF: IN-DA001CZ2CAS: 14088-96-1	95%	63.00 €~582.00 €	Tue 06 May 25
1-(3-Bromophenyl)imidazolidin-2-one REF: 54-OR15138CAS: 14088-96-1	95+% (nmr) (Typical Value in Batch COA)	32.00 €~132.00 €	Mon 05 May 25
1-(3-Bromophenyl)imidazolidin-2-one REF: 10-F620067CAS: 14088-96-1	98%	To inquire	Wed 14 May 25
1-(3-Bromophenyl)tetrahydro-2H-imidazol-2-one REF: 3D-PAA08896CAS: 14088-96-1	Min. 95%	- - -	Discontinued product