CAS 140909-80-4
:serrawettin W2
Description:
Serrawettin W2, with the CAS number 140909-80-4, is a biosurfactant produced by certain strains of the bacterium *Serratia marcescens*. This compound is characterized by its amphiphilic nature, which allows it to reduce surface tension and stabilize emulsions, making it useful in various applications, including pharmaceuticals, cosmetics, and food industries. Serrawettin W2 exhibits excellent wetting, dispersing, and emulsifying properties, which are attributed to its unique molecular structure comprising hydrophilic and hydrophobic regions. Additionally, it is biodegradable and environmentally friendly, making it a preferable alternative to synthetic surfactants. The substance has been studied for its potential antimicrobial properties, which can enhance its utility in formulations aimed at controlling microbial growth. Overall, Serrawettin W2 represents a significant advancement in the development of sustainable surfactants, aligning with the growing demand for eco-friendly chemical solutions.
Formula:C38H61N5O9
InChI:InChI=1/C38H61N5O9/c1-7-9-10-11-15-18-27-21-31(46)39-28(19-23(3)4)34(47)41-30(22-44)36(49)43-33(25(6)45)37(50)40-29(20-26-16-13-12-14-17-26)35(48)42-32(24(5)8-2)38(51)52-27/h12-14,16-17,23-25,27-30,32-33,44-45H,7-11,15,18-22H2,1-6H3,(H,39,46)(H,40,50)(H,41,47)(H,42,48)(H,43,49)/t24-,25+,27?,28+,29+,30-,32-,33?/m0/s1
Synonyms:- (3S,6R,12S,15R)-6-benzyl-3-[(2S)-butan-2-yl]-19-heptyl-9-[(1R)-1-hydroxyethyl]-12-(hydroxymethyl)-15-(2-methylpropyl)-1-oxa-4,7,10,13,16-pentaazacyclononadecane-2,5,8,11,14,17-hexone
- Serrawettin W2
- L-Isoleucine, N-(N-(N-(N-(N-(3-hydroxy-1-oxodecyl)-D-leucyl)-L-seryl)-L-threonyl)-D-phenylalanyl)-, rho-lactone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Cyclo(3-hydroxydecanoyl-D-leucyl-L-seryl-L-threonyl-D-phenylalanyl-L-isoleucyl)
CAS:Formula:C38H61N5O9Molecular weight:731.919Serrawettin W2
CAS:Serrawettin W2 is an extracellular cyclic lipopeptide that promotes flagellum-dependent.Formula:C38H61N5O9Color and Shape:SolidMolecular weight:731.932

