CAS 14091-08-8
:D-4-chlorophenylalanine
Description:
D-4-chlorophenylalanine is an amino acid derivative characterized by the presence of a chlorinated phenyl group at the para position relative to the amino acid backbone. It is a chiral compound, existing in a specific stereoisomeric form, which influences its biological activity and interactions. The presence of the chlorine atom enhances its hydrophobicity and can affect its binding properties in biological systems. D-4-chlorophenylalanine is often utilized in biochemical research, particularly in studies involving protein synthesis and enzyme inhibition, as it can serve as a non-canonical amino acid. Its incorporation into peptides or proteins can provide insights into structure-function relationships and the role of specific amino acid residues in enzymatic activity. Additionally, due to its structural similarity to phenylalanine, it may compete with natural substrates in various metabolic pathways. Safety and handling precautions are essential, as with many chemical substances, to mitigate any potential hazards associated with its use in laboratory settings.
Formula:C9H10ClNO2
InChI:InChI:1S/C9H10ClNO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)
Synonyms:- H-p-Chloro-D-Phe-OH
- D-4-Chlorophe
- 4-chloro-D-phenylalanine
- (2R)-2-amino-3-(4-chlorophenyl)propanoic acid
- H-D-Phe(4-Cl)-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
4-Chloro-D-phenylalanine, 95%
CAS:It is applied in the synthesis and placental binding potencies of photosensitive analogues of luteinizing hormone releasing hormone (lhrh) with agonistic and antagonistic structures. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentFormula:C9H10ClNO2Purity:95%Molecular weight:199.64H-p-Chloro-D-Phe-OH
CAS:Bachem ID: 4011117.
Formula:C9H10ClNO2Purity:> 99%Color and Shape:WhitishMolecular weight:199.64D-Phenylalanine, 4-chloro-
CAS:Formula:C9H10ClNO2Purity:97%Color and Shape:SolidMolecular weight:199.63424-Chloro-D-phenylalanine
CAS:4-Chloro-D-phenylalanineFormula:C9H10ClNO2Purity:98%Color and Shape: solidMolecular weight:199.63g/mol4-Chloro-D-phenylalanine
CAS:Formula:C9H10ClNO2Purity:95%Color and Shape:White powderMolecular weight:199.634-Chloro-D-phenylalanine
CAS:4-Chloro-D-phenylalanine is an amino acid that is structurally similar to insulin. It can inhibit the growth of cancer cells by preventing the conversion of hydroxide to hydrogen peroxide. This reaction prevents the formation of reactive oxygen species, which are involved in the development of cancer. 4-Chloro-D-phenylalanine also has a role in epidermal growth and wound healing. It promotes epidermal growth factor and fibronectin production and increases collagen synthesis, which aids in wound healing. 4-Chloro-D-phenylalanine can be used as a chronic treatment for diabetes mellitus type 2 because it has been shown to reduce blood glucose levels and promote insulin release from pancreatic beta cells.
Formula:C9H10NO2ClPurity:Min. 95%Molecular weight:199.63 g/mol








