CAS 14096-82-3: (T-4)-Tricarbonylnitrosylcobalt

Description:(T-4)-Tricarbonylnitrosylcobalt, with the CAS number 14096-82-3, is a coordination compound featuring cobalt in a low oxidation state, typically +1. This compound is characterized by its coordination of three carbonyl (CO) ligands and one nitrosyl (NO) ligand to the cobalt center. The presence of carbonyl groups imparts significant stability and contributes to the compound's unique electronic properties. The nitrosyl ligand, which can exhibit both neutral and anionic characteristics, adds to the complexity of the compound's reactivity and bonding. (T-4)-Tricarbonylnitrosylcobalt is often studied for its potential applications in catalysis and as a model for understanding metal-nitrosyl interactions. Its synthesis generally involves the reaction of cobalt salts with carbon monoxide and nitrosyl precursors under controlled conditions. The compound's properties, such as solubility and stability, can vary depending on the solvent and environmental conditions, making it a subject of interest in coordination chemistry and materials science.

Formula:C₃CoNO₄

InChI:InChI=1S/3CO.Co.NO/c3*1-2;;1-2/q;;;-1;+1

InChI key:InChIKey=RVSVSZMFMFSHQQ-UHFFFAOYSA-N

SMILES:O#C[Co-](C#O)(C#O)[N]#[O+]

Synonyms:
(T-4)-Tricarbonylnitrosylcobalt
Cobalt carbonyl nitrosyl (Co(CO)<sub>3</sub>(NO))
Cobalt tricarbonyl mononitrosyl
Cobalt, nitrosyltricarbonyl-
Cobalt, tricarbonylnitrosyl-
Cobalt, tricarbonylnitrosyl-, (T-4)-
Nitrosylcobalt tricarbonyl
Nitrosyltricarbonylcobalt
Tricarbonylnitrosylcobalt
Cobalt carbonyl nitrosyl (Co(CO)3(NO))
See more synonyms

Found 5 products.

Product data	Purity	Price range	Estimated delivery
Tricarbonylnitrosylcobalt REF: 02-023151CAS: 14096-82-3	- - -	To inquire	Mon 31 Mar 25
Cobalt tricarbonyl nitrosyl REF: 08-27-0500CAS: 14096-82-3	- - -	76.00 €~912.00 €	Tue 01 Apr 25
Cobalt, tricarbonylnitrosyl-, (T-4)- REF: IN-DA001FPCCAS: 14096-82-3	- - -	To inquire	Tue 08 Apr 25
COBALT TRICARBONYL NITROSYL REF: 3H-INCO032CAS: 14096-82-3	- - -	- - -	Discontinued product
Tricarbonylnitrosylcobalt REF: 3D-PAA09682CAS: 14096-82-3	Min. 95%	- - -	Discontinued product