CAS 14096-82-3
:(T-4)-Tricarbonylnitrosylcobalt
Description:
(T-4)-Tricarbonylnitrosylcobalt, with the CAS number 14096-82-3, is a coordination compound featuring cobalt in a low oxidation state, typically +1. This compound is characterized by its coordination of three carbonyl (CO) ligands and one nitrosyl (NO) ligand to the cobalt center. The presence of carbonyl groups imparts significant stability and contributes to the compound's unique electronic properties. The nitrosyl ligand, which can exhibit both neutral and anionic characteristics, adds to the complexity of the compound's reactivity and bonding. (T-4)-Tricarbonylnitrosylcobalt is often studied for its potential applications in catalysis and as a model for understanding metal-nitrosyl interactions. Its synthesis generally involves the reaction of cobalt salts with carbon monoxide and nitrosyl precursors under controlled conditions. The compound's properties, such as solubility and stability, can vary depending on the solvent and environmental conditions, making it a subject of interest in coordination chemistry and materials science.
Formula:C3CoNO4
InChI:InChI=1S/3CO.Co.NO/c3*1-2;;1-2/q;;;-1;+1
InChI key:InChIKey=RVSVSZMFMFSHQQ-UHFFFAOYSA-N
SMILES:[Co-](C#O)(C#O)(C#O)[N]#[O+]
Synonyms:- (T-4)-Tricarbonylnitrosylcobalt
- Cobalt carbonyl nitrosyl (Co(CO)<sub>3</sub>(NO))
- Cobalt tricarbonyl mononitrosyl
- Cobalt, nitrosyltricarbonyl-
- Cobalt, tricarbonylnitrosyl-
- Cobalt, tricarbonylnitrosyl-, (T-4)-
- Nitrosylcobalt tricarbonyl
- Nitrosyltricarbonylcobalt
- Tricarbonylnitrosylcobalt
- Cobalt carbonyl nitrosyl (Co(CO)3(NO))
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Tricarbonylnitrosylcobalt
CAS:Tricarbonylnitrosylcobalt is used as the Co metalorganic precursor. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU refe
Formula:C3CoNO4Molecular weight:172.97Cobalt tricarbonyl nitrosyl
CAS:Cobalt tricarbonyl nitrosyl
Formula:Co(CO)3NOColor and Shape:dark red liq.Molecular weight:172.97Cobalt, tricarbonylnitrosyl-, (T-4)-
CAS:Formula:C3CoNO4Color and Shape:LiquidMolecular weight:172.9696


