CAS 14098-41-0
:[3,4]-Dibenzo-21-crown-7
Description:
[3,4]-Dibenzo-21-crown-7 is a member of the crown ether family, characterized by its ability to selectively bind cations due to its unique molecular structure. This compound features a cyclic arrangement of ether linkages and aromatic rings, which enhances its solubility in organic solvents and its affinity for certain metal ions. The "21" in its name indicates that the crown ether has 21 atoms in its ring, including both oxygen and carbon atoms. Its structure allows for the formation of stable complexes with various cations, particularly alkali and alkaline earth metals, making it useful in applications such as ion-selective electrodes, extraction processes, and as a phase transfer catalyst. Additionally, the presence of the dibenzo moieties contributes to its rigidity and influences its binding properties. The compound is typically synthesized through specific organic reactions involving phenolic compounds and can be characterized using techniques such as NMR spectroscopy and mass spectrometry. Overall, [3,4]-Dibenzo-21-crown-7 is notable for its selective ion-binding capabilities and versatility in chemical applications.
Formula:C22H28O7
InChI:InChI=1/C22H28O7/c1-3-7-21-19(5-1)26-15-11-23-9-10-24-12-16-27-20-6-2-4-8-22(20)29-18-14-25-13-17-28-21/h1-8H,9-18H2
SMILES:c1ccc2c(c1)OCCOCCOCCOc1ccccc1OCCOCCO2
Synonyms:- Dibenzo-21-crown-7
- 6,7,9,10,12,13,20,21,23,24-Decahydrodibenzo[B,K][1,4,7,10,13,16,19]Heptaoxacyclohenicosine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Dibenzo-21-crown 7-Ether
CAS:Formula:C22H28O7Purity:>96.0%(GC)Color and Shape:White to Light yellow to Light red powder to crystalMolecular weight:404.46Dibenzo[b,k][1,4,7,10,13,16,19]heptaoxacycloheneicosin, 6,7,9,10,12,13,20,21,23,24-decahydro-
CAS:Formula:C22H28O7Purity:96%Color and Shape:SolidMolecular weight:404.4535Dibenzo-21-crown 7-Ether
CAS:Dibenzo-21-crown 7-Ether is a chemical that has been synthesized to have high resistance to radiation, stability in organic solutions and good transport properties. This chemical is an extractant for phosphorus pentoxide and trifluoroacetic acid. Dibenzo-21-crown 7-Ether is also a molecule that can be used as an optical property standard. It is a synthetic compound with a constant boiling point of 127 degrees celcius and a molecular weight of 248. It also has the ability to extract sodium nitrate from water solutions.Purity:Min. 95%



