CAS 1409950-09-9

N-(1,1-Dimethylethyl)-1-formylcyclopropanesulfonamide

Description:

N-(1,1-Dimethylethyl)-1-formylcyclopropanesulfonamide is a chemical compound characterized by its unique structure, which includes a cyclopropane ring, a formyl group, and a sulfonamide functional group. The presence of the 1,1-dimethylethyl group contributes to its steric bulk, influencing its reactivity and interactions with other molecules. This compound is likely to exhibit properties typical of sulfonamides, such as potential antibacterial activity, although specific biological activities would depend on its precise structure and substituents. The cyclopropane moiety may impart strain, affecting the compound's stability and reactivity. Additionally, the formyl group can participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Overall, the characteristics of N-(1,1-Dimethylethyl)-1-formylcyclopropanesulfonamide suggest it may have applications in medicinal chemistry or materials science, although further studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₈H₁₅NO₃S

InChI: InChI=1S/C8H15NO3S/c1-7(2,3)9-13(11,12)8(6-10)4-5-8/h6,9H,4-5H2,1-3H3

InChI key: InChIKey=HWRWXSHAVJWSCE-UHFFFAOYSA-N

SMILES: S(NC(C)(C)C)(=O)(=O)C1(C=O)CC1

Synonyms:

• Cyclopropanesulfonamide, N-(1,1-dimethylethyl)-1-formyl-
• N-(1,1-Dimethylethyl)-1-formylcyclopropanesulfonamide
• N-(tert-Butyl)-1-formylcyclopropane-1-sulfonamide

N-tert-Butyl-1-formylcyclopropane-1-sulfonamide

CAS: 1409950-09-9

Versatile small molecule scaffold

Formula: C₈H₁₅NO₃S

Purity: Min. 95%

Molecular weight: 205.28 g/mol

Ref: 3D-JGC95009