CymitQuimica logo

CAS 1409950-69-1

:

(2E)-3-(2-Fluoro-3-methoxyphenyl)-2-propenoic acid

Description:
(2E)-3-(2-Fluoro-3-methoxyphenyl)-2-propenoic acid, also known by its CAS number 1409950-69-1, is an organic compound characterized by its propenoic acid structure, which features a double bond between the second and third carbon atoms. The presence of a fluoro substituent and a methoxy group on the aromatic ring contributes to its unique chemical properties, including potential reactivity and solubility characteristics. This compound may exhibit specific biological activities due to its structural features, making it of interest in medicinal chemistry and drug development. The fluoro group can enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the methoxy group can affect the electronic properties of the aromatic ring, potentially altering its reactivity. Overall, this compound's characteristics, including its molecular structure, functional groups, and potential applications, make it a subject of interest in various fields, including pharmaceuticals and materials science.
Formula:C10H9FO3
InChI:InChI=1S/C10H9FO3/c1-14-8-4-2-3-7(10(8)11)5-6-9(12)13/h2-6H,1H3,(H,12,13)/b6-5+
InChI key:InChIKey=XWKXMMLZGWSNHQ-AATRIKPKSA-N
SMILES:C(=C/C(O)=O)\C1=C(F)C(OC)=CC=C1
Synonyms:
  • 2-Propenoic acid, 3-(2-fluoro-3-methoxyphenyl)-, (2E)-
  • (2E)-3-(2-Fluoro-3-methoxyphenyl)-2-propenoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.