CAS 141-63-9: Dodecamethylpentasiloxane
Description:Dodecamethylpentasiloxane, also known by its CAS number 141-63-9, is a siloxane compound characterized by a linear chain of silicon and oxygen atoms, specifically containing five silicon atoms and twelve methyl groups attached to the silicon atoms. This compound is part of a larger class of organosilicon compounds known for their unique properties, including low surface tension, thermal stability, and resistance to moisture. Dodecamethylpentasiloxane is typically a colorless, odorless liquid that exhibits low viscosity and high volatility. It is often used in various applications, including as a lubricant, in cosmetics for its smooth feel, and in industrial formulations due to its ability to enhance the performance of other materials. Additionally, it is known for its low toxicity and environmental persistence, making it a subject of interest in both industrial and research settings. Its unique molecular structure contributes to its effectiveness in reducing friction and improving the spreadability of formulations.
Formula:C12H36O4Si5
InChI:InChI=1S/C12H36O4Si5/c1-17(2,3)13-19(7,8)15-21(11,12)16-20(9,10)14-18(4,5)6/h1-12H3
InChI key:InChIKey=FBZANXDWQAVSTQ-UHFFFAOYSA-N
SMILES:O([Si](O[Si](O[Si](C)(C)C)(C)C)(C)C)[Si](O[Si](C)(C)C)(C)C
- Synonyms:
- 1,1,1,3,3,5,5,7,7,9,9,9-Dodecamethylpentasiloxane
- Brn 1792965
- DC 200 Fluid 2
- Kf 96L2Cs
- Md 3M
- PSF 2Cst Pure Silicone Fluid
- Pentasiloxane, 1,1,1,3,3,5,5,7,7,9,9,9-dodecamethyl-
- Pentasiloxane, dodecamethyl-
- Psf 2Cst
- 4-04-00-04124 (Beilstein Handbook Reference)
- See more synonyms
- Dodecamethylpentasiloxane
