CAS 141-64-0

1-Chloro-5,5,7,7-tetramethyl-2-octene

Description:

1-Chloro-5,5,7,7-tetramethyl-2-octene is an organic compound characterized by its unique structure, which includes a chloro substituent and multiple methyl groups attached to a carbon chain. This compound features a double bond between the second and third carbon atoms, contributing to its classification as an alkene. The presence of the chlorine atom introduces reactivity, making it a potential candidate for various chemical reactions, such as nucleophilic substitution or elimination reactions. The bulky tetramethyl groups enhance steric hindrance, which can influence the compound's reactivity and physical properties, such as boiling and melting points. Typically, compounds of this nature are used in organic synthesis and may serve as intermediates in the production of more complex molecules. Additionally, the compound's hydrophobic nature suggests limited solubility in water, while it may dissolve in organic solvents. Safety precautions should be observed when handling this substance due to its potential health hazards associated with chlorine-containing compounds.

Formula: C₁₂H₂₃Cl

InChI: InChI=1S/C12H23Cl/c1-11(2,3)10-12(4,5)8-6-7-9-13/h6-7H,8-10H2,1-5H3

InChI key: InChIKey=DVOYYVNTAWFQAV-UHFFFAOYSA-N

SMILES: C(C(CC=CCCl)(C)C)C(C)(C)C

Synonyms:

• 1-Chloro-5,5,7,7-tetramethyl-2-octene
• 2-Octene, 1-chloro-5,5,7,7-tetramethyl