CAS 141-95-7
:Sodium malonate
Description:
Sodium malonate is the sodium salt of malonic acid, characterized by its white crystalline appearance and hygroscopic nature. It is commonly used as a buffering agent in biochemical applications due to its ability to maintain pH levels. Sodium malonate is soluble in water, which facilitates its use in various aqueous solutions. The compound has a molecular formula of C3H3NaO4 and typically exhibits a slightly alkaline pH when dissolved. It is non-toxic and generally regarded as safe for use in laboratory and food applications. In organic synthesis, sodium malonate serves as a versatile building block, particularly in the synthesis of various esters and as a reagent in the malonic ester synthesis, which is a method for producing carboxylic acids. Additionally, it can act as a competitive inhibitor in certain enzymatic reactions, making it useful in biochemical research. Overall, sodium malonate is valued for its buffering capacity, solubility, and role in organic synthesis.
Formula:C3H4O4·2Na
InChI:InChI=1S/C3H4O4.2Na/c4-2(5)1-3(6)7;;/h1H2,(H,4,5)(H,6,7);;
InChI key:InChIKey=SXJCWCGNPYHALZ-UHFFFAOYSA-N
SMILES:C(C(O)=O)C(O)=O.[Na]
Synonyms:- DISODIUM MALONATE 99% puriss
- Disodium Propanedioate
- Disodium malonate
- Malonic acid disodium salt
- Propanedioic Acid, Monosodium Salt, Monohydrate
- Propanedioic acid, disodium salt
- Propanedioic acid, sodium salt (1:2)
- Sodium Malonate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Disodium Malonate
CAS:Formula:C3H2Na2O4Purity:>99.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:148.02Malonic acid disodium salt, 99%
CAS:sodium malonate propanedioic acid sodium salt (1:2) sodium malonate dibasic propanedioic acid disodium salt malonic acid sodium salt malonic acid disodium salt malonic acid disodium saltFormula:C3H2Na2O4Purity:99%Color and Shape:White, powderMolecular weight:148.03Sodium Malonate extrapure, 99%
CAS:Formula:C3H2O4Na2Purity:min. 99%Color and Shape:White, Crystalline Powder, Clear, ColourlessMolecular weight:148.03Malonicaciddisodiumsalt
CAS:Formula:C3H2Na2O4Purity:99%Color and Shape:SolidMolecular weight:148.0251





