CAS 141034-42-6
:DAT 582
Description:
DAT 582, with the CAS number 141034-42-6, is a chemical compound that belongs to the class of small molecules. It is primarily recognized for its role in pharmaceutical research and development, particularly in the context of drug discovery. The compound exhibits specific biological activity, which may include interactions with certain biological targets, making it of interest in medicinal chemistry. Its molecular structure and functional groups contribute to its reactivity and potential therapeutic applications. As with many compounds in this category, DAT 582 may undergo various forms of characterization, including spectroscopic analysis and biological assays, to determine its efficacy and safety profile. Additionally, its solubility, stability, and pharmacokinetic properties are crucial for understanding its behavior in biological systems. Researchers often explore such compounds for their potential in treating specific diseases or conditions, emphasizing the importance of thorough investigation into their characteristics and mechanisms of action.
Formula:C22H29Cl2N5O
InChI:InChI=1/C22H27N5O.2ClH/c1-16-6-5-7-17(12-16)13-27-11-10-26(2)14-18(15-27)23-22(28)21-19-8-3-4-9-20(19)24-25-21;;/h3-9,12,18H,10-11,13-15H2,1-2H3,(H,23,28)(H,24,25);2*1H/t18-;;/m1../s1
Synonyms:- Dat-582
- N-(1-Methyl-4-(3-methylbenzyl)hexahydro-1H-1,4-diazepin-6-yl)-1H-indazole-3-carboxamide dihydrochloride
- N-[(6R)-1-methyl-4-(3-methylbenzyl)-1,4-diazepan-6-yl]-1H-indazole-3-carboxamide dihydrochloride
- AD 5819
- Dat 582
- 1H-Indazole-3-carboxamide, N-(hexahydro-1-methyl-4-((3-methylphenyl)methyl)-1H-1,4-diazepin-6-yl)-, dihydrochloride, (R)-
- AS 5370
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
DAT 582
CAS:<p>DAT 582 is a novel serotonin3 receptor antagonist. It is also an effective and long-lasting antiemetic agent</p>Formula:C22H28ClN5OPurity:98%Color and Shape:SolidMolecular weight:413.95
