CymitQuimica logo

CAS 141046-52-8

:

Bicyclo[2.1.1]hexane-1,4-dicarboxylic acid, monomethyl ester

Description:
Bicyclo[2.1.1]hexane-1,4-dicarboxylic acid, monomethyl ester, identified by its CAS number 141046-52-8, is an organic compound characterized by its bicyclic structure, which consists of a bicyclo[2.1.1]hexane framework with two carboxylic acid functional groups, one of which is esterified with a methyl group. This compound exhibits properties typical of dicarboxylic acids and their esters, including potential solubility in organic solvents and moderate polarity. The presence of the ester group can influence its reactivity, making it more amenable to nucleophilic attack compared to the corresponding acid. Additionally, the bicyclic structure contributes to its rigidity and may affect its conformational properties, which can be significant in applications such as polymer synthesis or as intermediates in organic synthesis. The compound's unique structure may also impart specific physical properties, such as melting and boiling points, which are influenced by intermolecular interactions. Overall, this compound is of interest in various fields, including materials science and medicinal chemistry, due to its distinctive structural features.
Formula:C9H12O4
InChI:InChI=1S/C9H12O4/c1-13-7(12)9-3-2-8(4-9,5-9)6(10)11/h2-5H2,1H3,(H,10,11)
InChI key:YXVUNUBFPAVHRP-UHFFFAOYSA-N
SMILES:COC(=O)C12CCC(C1)(C2)C(=O)O
Found 7 products.