CAS 141071-79-6
:1-(Phenylmethyl)-1H-indole-3-propanoic acid
Description:
1-(Phenylmethyl)-1H-indole-3-propanoic acid, also known by its CAS number 141071-79-6, is a chemical compound that features an indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound is characterized by the presence of a phenylmethyl group and a propanoic acid moiety, contributing to its unique properties. It typically exhibits moderate solubility in organic solvents and may have limited solubility in water, depending on the pH. The presence of the indole structure suggests potential biological activity, as indoles are known to participate in various biochemical processes. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or pathways. Its molecular interactions, stability, and reactivity can be influenced by the functional groups present, making it a subject of study in medicinal chemistry and related fields. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C18H17NO2
InChI:InChI=1S/C18H17NO2/c20-18(21)11-10-15-13-19(12-14-6-2-1-3-7-14)17-9-5-4-8-16(15)17/h1-9,13H,10-12H2,(H,20,21)
InChI key:InChIKey=QTUJYJWSZIVMMF-UHFFFAOYSA-N
SMILES:C(N1C=2C(C(CCC(O)=O)=C1)=CC=CC2)C3=CC=CC=C3
Synonyms:- 1H-Indole-3-propanoic acid, 1-(phenylmethyl)-
- 3-(1-Benzyl-1H-indol-3-yl)propanoic acid
- 1-Benzylindole-3-propionic acid
- 1-(Phenylmethyl)-1H-indole-3-propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
