CAS 141109-18-4
:Benzeneacetic acid, 2-chloro-alpha-[[2-(2-thienyl)ethyl]amino]-, methyl ester, hydrochloride (1:1)
Description:
Benzeneacetic acid, 2-chloro-alpha-[[2-(2-thienyl)ethyl]amino]-, methyl ester, hydrochloride (1:1), with CAS number 141109-18-4, is a chemical compound characterized by its complex structure that includes a benzeneacetic acid moiety, a chloro substituent, and a thienyl-ethyl amino group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its hydrochloride form. The presence of the chloro group and the thienyl ring contributes to its unique reactivity and potential biological activity, making it of interest in pharmaceutical research. Its hydrochloride salt form enhances its stability and solubility, which is advantageous for various applications, including drug formulation. The compound may exhibit specific pharmacological properties, potentially influencing neurotransmitter systems or other biological pathways, although detailed studies would be necessary to elucidate its full biological profile. As with many chemical substances, handling should be conducted with care, adhering to safety protocols due to potential toxicity or reactivity.
Formula:C15H17Cl2NO2S
InChI:InChI=1/C15H16ClNO2S.ClH/c1-19-15(18)14(12-6-2-3-7-13(12)16)17-9-8-11-5-4-10-20-11;/h2-7,10,14,17H,8-9H2,1H3;1H
SMILES:COC(=O)C(c1ccccc1Cl)NCCc1cccs1.Cl
Synonyms:- (+)Methyl α-(2-thienylethylamino)(2-chlorophenyl)acetate HCl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Clopidogrel Open Ring Methyl Ester Hydrochloride (methyl 2-(2-chlorophenyl)-2-((2-(thiophen-2-yl)ethyl)amino)acetate, hydrochloride)
CAS:Nucleic acids and their salts, whether or not chemically defined; other heterocyclic compounds, nesoiFormula:C15H16ClNO2SHClColor and Shape:White Off-White SolidMolecular weight:346.28Methyl 2-(2-chlorophenyl)-2-((2-(thiophen-2-yl)ethyl)amino)acetate hydrochloride
CAS:Methyl 2-(2-chlorophenyl)-2-((2-(thiophen-2-yl)ethyl)amino)acetate hydrochloridePurity:95%Molecular weight:346.28g/molrac-Clopidogrel EP Impurity F HCl
CAS:Formula:C15H16ClNO2S·HClColor and Shape:White To Off-White SolidMolecular weight:309.82 36.46




