
CAS 141113-28-2
:(αR)-α-(2,4-Difluorophenyl)-3-[(1E)-2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethenyl]-α-(1H-1,2,4-triazol-1-ylmethyl)-1H-1,2,4-triazole-1-ethanol
Description:
The chemical substance with the name "(αR)-α-(2,4-Difluorophenyl)-3-[(1E)-2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethenyl]-α-(1H-1,2,4-triazol-1-ylmethyl)-1H-1,2,4-triazole-1-ethanol" and CAS number "141113-28-2" is a complex organic compound characterized by its multi-functional structure, which includes triazole rings and fluorinated phenyl groups. This compound exhibits significant biological activity, often studied for its potential applications in pharmaceuticals, particularly as an antifungal agent. The presence of fluorine atoms enhances its lipophilicity and metabolic stability, which can improve its efficacy and bioavailability. Additionally, the triazole moieties contribute to its ability to interact with biological targets, making it a subject of interest in medicinal chemistry. Its synthesis and characterization involve advanced organic chemistry techniques, and its properties can be influenced by the stereochemistry and substituents present in the molecule. Overall, this compound represents a class of triazole-based derivatives that are valuable in drug discovery and development.
Formula:C24H20F6N6O2
InChI:InChI=1S/C24H20F6N6O2/c25-17-4-7-19(20(26)9-17)23(37,10-35-14-31-13-33-35)11-36-15-32-21(34-36)8-3-16-1-5-18(6-2-16)38-12-24(29,30)22(27)28/h1-9,13-15,22,37H,10-12H2/b8-3+/t23-/m1/s1
InChI key:InChIKey=FZEJTXCSLUORDW-DHXBXMGCSA-N
SMILES:[C@@](CN1N=C(/C=C/C2=CC=C(OCC(C(F)F)(F)F)C=C2)N=C1)(CN3C=NC=N3)(O)C4=C(F)C=C(F)C=C4
Synonyms:- D 0870
- (αR)-α-(2,4-Difluorophenyl)-3-[(1E)-2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethenyl]-α-(1H-1,2,4-triazol-1-ylmethyl)-1H-1,2,4-triazole-1-ethanol
- 1H-1,2,4-Triazole-1-ethanol, α-(2,4-difluorophenyl)-3-[(1E)-2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethenyl]-α-(1H-1,2,4-triazol-1-ylmethyl)-, (αR)-
- DO 870
- 1H-1,2,4-Triazole-1-ethanol, α-(2,4-difluorophenyl)-3-[2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethenyl]-α-(1H-1,2,4-triazol-1-ylmethyl)-, [R-(E)]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
ZD 0870
CAS:<p>ZD 0870, used to treat infections caused by fluconazole-resistant candida albicans.</p>Formula:C24H20F6N6O2Color and Shape:SolidMolecular weight:538.45
