CymitQuimica logo

CAS 14112-98-2

:

7-Oxooctanoic acid

Description:
7-Oxooctanoic acid, also known as capryloylglycine, is a fatty acid derivative characterized by its eight-carbon chain with a ketone functional group at the seventh carbon position. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is soluble in organic solvents and exhibits limited solubility in water due to its hydrophobic alkyl chain. The presence of the ketone group contributes to its reactivity, allowing it to participate in various chemical reactions, including esterification and oxidation. 7-Oxooctanoic acid is often utilized in the synthesis of surfactants, emulsifiers, and other chemical intermediates. Additionally, it has applications in the cosmetic and pharmaceutical industries, where it may serve as a preservative or antimicrobial agent. Its safety profile indicates low toxicity, but standard handling precautions should be observed. Overall, 7-Oxooctanoic acid is a versatile compound with significant industrial relevance.
Formula:C8H14O3
InChI:InChI=1S/C8H14O3/c1-7(9)5-3-2-4-6-8(10)11/h2-6H2,1H3,(H,10,11)
InChI key:InChIKey=OSAHCBHKCKPJGI-UHFFFAOYSA-N
SMILES:C(CC(C)=O)CCCC(O)=O
Synonyms:
  • 7-Ketooctanoic acid
  • Octanoic acid, 7-oxo-
  • 7-Oxooctanoic acid
Found 4 products.