CymitQuimica logo

CAS 14118-40-2

:

Phosphorocyanidous difluoride

Description:
Phosphorocyanidous difluoride, with the CAS number 14118-40-2, is a chemical compound characterized by its unique molecular structure, which includes phosphorus, nitrogen, and fluorine atoms. It is typically represented by the formula F2P(NC) and is known for its high reactivity and potential toxicity. The compound exhibits properties typical of organophosphorus compounds, including the ability to form stable complexes with various nucleophiles. Its physical state can vary, but it is generally a colorless to pale yellow liquid or gas, depending on the conditions. Phosphorocyanidous difluoride is primarily used in specialized applications, including as a reagent in organic synthesis and in the production of other phosphorus-containing compounds. Due to its reactivity, it requires careful handling and storage under controlled conditions to prevent hazardous reactions. Additionally, it may pose environmental and health risks, necessitating appropriate safety measures during its use and disposal. Overall, phosphorocyanidous difluoride is an important compound in the field of chemistry, particularly in the study of phosphorus chemistry and its applications.
Formula:CF2NP
InChI:InChI=1/CF2NP/c2-5(3)1-4
SMILES:C(#N)P(F)F
Synonyms:
  • Difluorocyanophosphine
  • Phosphorocyanidous difluoride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.