CymitQuimica logo

CAS 141196-99-8

:

4-amino-5-chloro-N-[(1S,7aS)-hexahydro-1H-pyrrolizin-1-ylmethyl]-2-methoxybenzamide

Description:
4-amino-5-chloro-N-[(1S,7aS)-hexahydro-1H-pyrrolizin-1-ylmethyl]-2-methoxybenzamide, with the CAS number 141196-99-8, is a chemical compound characterized by its complex structure, which includes an amino group, a chloro substituent, and a methoxy group attached to a benzamide framework. The presence of the hexahydro-pyrrolizin moiety indicates that it has a bicyclic structure, contributing to its potential biological activity. This compound may exhibit properties such as solubility in organic solvents and varying stability depending on environmental conditions. Its functional groups suggest potential interactions with biological targets, making it of interest in medicinal chemistry. The specific stereochemistry, indicated by the (1S,7aS) notation, implies that the compound may have unique spatial arrangements that could influence its pharmacological properties. Overall, this compound's characteristics make it a candidate for further investigation in drug development and related fields.
Formula:C16H22ClN3O2
InChI:InChI=1/C16H22ClN3O2/c1-22-15-8-13(18)12(17)7-11(15)16(21)19-9-10-4-6-20-5-2-3-14(10)20/h7-8,10,14H,2-6,9,18H2,1H3,(H,19,21)/t10-,14-/m0/s1
SMILES:COc1cc(c(cc1C(=NC[C@@H]1CCN2CCC[C@@H]12)O)Cl)N
Synonyms:
  • benzamide, 4-amino-5-chloro-N-[[(1S,7aS)-hexahydro-1H-pyrrolizin-1-yl]methyl]-2-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.