CAS 141206-20-4
:perilloside A
Description:
Perilloside A, with the CAS number 141206-20-4, is a natural compound primarily derived from the plant species Perilla frutescens, commonly known as perilla or shiso. This compound belongs to the class of glycosides, characterized by the presence of a sugar moiety attached to a non-sugar aglycone. Perilloside A exhibits various biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it of interest in pharmacological research. Its structure typically features a phenolic backbone, which contributes to its bioactivity. Additionally, perilloside A is soluble in polar solvents, which is a common trait among glycosides. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Research into perilloside A continues to explore its therapeutic potential and mechanisms of action, particularly in the context of traditional medicine and modern pharmacology. Overall, perilloside A represents a significant area of study within natural product chemistry and its applications in health and medicine.
Formula:C16H26O6
InChI:InChI=1/C16H26O6/c1-9(2)11-5-3-10(4-6-11)8-21-16-15(20)14(19)13(18)12(7-17)22-16/h3,11-20H,1,4-8H2,2H3/t11-,12-,13-,14+,15-,16-/m1/s1
Synonyms:- Perilloside A
- [(4S)-4-(1-methylethenyl)cyclohex-1-en-1-yl]methyl beta-D-glucopyranoside
- beta-D-Glucopyranoside, (4-(1-methylethenyl)-1-cyclohexen-1-yl)methyl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
S-(-)-Perillyl alcohol glucoside
CAS:S-(-)-Perillyl alcohol glucoside is a glycoconjugate that has been shown to inhibit β-glucosidase and pancreatic lipase. It is used in the treatment of cancers, such as colorectal cancer, by inhibiting glucose uptake into cells. S-(-)-Perillyl alcohol glucoside may also have anticancer effects by inhibiting glucose transporters and caspases.
Formula:C16H26O6Purity:Min. 95%Color and Shape:PowderMolecular weight:314.37 g/molRef: 3D-MP182736
Discontinued product
