CymitQuimica logo

CAS 141215-32-9

:

2,1,3-Benzothiadiazole-5,6-diamine, 4,7-dibromo-

Description:
2,1,3-Benzothiadiazole-5,6-diamine, 4,7-dibromo- is a chemical compound characterized by its unique structure, which includes a benzothiadiazole core substituted with amino groups and bromine atoms. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential applications in organic electronics, such as organic semiconductors and photovoltaic devices. The presence of bromine enhances its electronic properties and may improve its stability and solubility in various solvents. Additionally, the amino groups can participate in hydrogen bonding and may influence the compound's reactivity and interaction with other molecules. The compound is of interest in materials science and organic synthesis, where its electronic characteristics can be exploited for developing advanced materials. Safety data sheets and handling guidelines should be consulted for information on toxicity and safe handling practices, as with any chemical substance. Overall, this compound represents a significant area of research in the field of organic chemistry and materials science.
Formula:C6H4Br2N4S
InChI:InChI=1S/C6H4Br2N4S/c7-1-3(9)4(10)2(8)6-5(1)11-13-12-6/h9-10H2
InChI key:SFFHORYSGHXVGU-UHFFFAOYSA-N
SMILES:C1(=C(C2=NSN=C2C(=C1N)Br)Br)N
Found 4 products.