CAS 141234-08-4

5-Quinoxalinecarboxaldehyde

Description:

5-Quinoxalinecarboxaldehyde is an organic compound characterized by its quinoxaline structure, which consists of a fused bicyclic system containing two nitrogen atoms. This compound features an aldehyde functional group (-CHO) attached to the carbon of the carboxylic acid derivative, making it a valuable intermediate in organic synthesis. It is typically a yellow to brown solid, exhibiting moderate solubility in polar organic solvents. The presence of the aldehyde group allows for reactivity in various chemical reactions, including condensation and oxidation, making it useful in the synthesis of more complex molecules. Additionally, 5-Quinoxalinecarboxaldehyde may exhibit biological activity, which has garnered interest in medicinal chemistry for potential applications in drug development. Its unique structure and functional groups contribute to its potential utility in various fields, including pharmaceuticals and materials science. As with many organic compounds, handling should be done with care, considering safety data and proper laboratory protocols.

Formula: C₉H₆N₂O

InChI: InChI=1S/C9H6N2O/c12-6-7-2-1-3-8-9(7)11-5-4-10-8/h1-6H

InChI key: InChIKey=XNGYMORBKJLAQE-UHFFFAOYSA-N

SMILES: C(=O)C=1C2=C(C=CC1)N=CC=N2

Synonyms:

• 5-Quinoxalinecarboxaldehyde

5-Quinoxalinecarboxaldehyde

CAS: 141234-08-4

Formula: C₉H₆N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 158.1567

Ref: IN-DA001G4G

Quinoxaline-5-carboxaldehyde

CAS: 141234-08-4

Quinoxaline-5-carboxaldehyde

Purity: 95%

Molecular weight: 158.16g/mol

Ref: 54-OR17071

quinoxaline-5-carbaldehyde

CAS: 141234-08-4

Formula: C₉H₆N₂O

Purity: 98%

Color and Shape: Light brown powder

Molecular weight: 158.16

Ref: 10-F369617

Quinoxaline-5-carboxaldehyde

CAS: 141234-08-4

Quinoxaline-5-carboxaldehyde is a versatile building block and reagent for organic chemistry. It is a complex compound that can be used as a research chemical or as a speciality chemical, with high quality and a useful scaffold. This compound has been shown to be an intermediate in the synthesis of other compounds, such as quinoxaline-5-carboxylic acid.

Formula: C₉H₆N₂O

Purity: Min. 95%

Color and Shape: Off-White Powder

Molecular weight: 158.16 g/mol

Ref: 3D-FQ64820