
CAS 141256-04-4
:Stimulon
Description:
Stimulon, with the CAS number 141256-04-4, is a chemical compound that is primarily recognized for its application in the field of biochemistry and pharmacology. It is often associated with stimulant properties, which may influence neurotransmitter activity in the brain. The compound is typically characterized by its ability to enhance cognitive functions, increase alertness, and potentially improve physical performance. Stimulon may interact with various receptors and pathways, leading to effects such as increased energy levels and improved mood. However, like many stimulants, it may also carry risks of side effects, including increased heart rate, anxiety, or dependency with prolonged use. Its safety profile and efficacy are subjects of ongoing research, and it is essential for users to be aware of dosage and potential interactions with other substances. As with any chemical, proper handling and adherence to regulatory guidelines are crucial for ensuring safety and effectiveness in its applications.
Formula:C92H148O46
InChI:InChI=1S/C92H148O46/c1-13-36(3)46(126-54(102)25-41(98)24-47(37(4)14-2)127-80-62(110)58(106)49(30-94)128-80)23-40(97)26-55(103)131-69-39(6)125-82(73(65(69)113)136-79-64(112)60(108)68(38(5)124-79)132-78-67(115)70(45(100)32-122-78)133-84-75(116)91(120,34-96)35-123-84)138-85(119)92-22-21-86(7,8)27-43(92)42-15-16-51-87(9)19-18-53(88(10,33-95)50(87)17-20-89(51,11)90(42,12)28-52(92)101)130-83-74(137-81-63(111)59(107)57(105)48(29-93)129-81)71(66(114)72(135-83)76(117)118)134-77-61(109)56(104)44(99)31-121-77/h15,33,36-41,43-53,56-75,77-84,93-94,96-101,104-116,120H,13-14,16-32,34-35H2,1-12H3,(H,117,118)/t36-,37-,38-,39+,40-,41-,43-,44+,45+,46-,47-,48+,49-,50+,51+,52+,53-,56-,57-,58-,59-,60-,61+,62+,63+,64+,65-,66-,67+,68-,69-,70-,71-,72-,73+,74+,75-,77-,78-,79-,80+,81-,82-,83+,84-,87-,88-,89+,90+,91+,92+/m0/s1
InChI key:InChIKey=DRHZYJAUECRAJM-DWSYSWFDSA-N
SMILES:C(O[C@H]1[C@H](O[C@H]2[C@H](O)[C@H](O)[C@@H](O[C@H]3[C@H](O)[C@@H](O[C@H]4[C@H](O)[C@](CO)(O)CO4)[C@H](O)CO3)[C@H](C)O2)[C@@H](O)[C@@H](OC(C[C@H](C[C@H](OC(C[C@H](C[C@H](O[C@@H]5O[C@@H](CO)[C@H](O)[C@H]5O)[C@H](CC)C)O)=O)[C@H](CC)C)O)=O)[C@@H](C)O1)(=O)[C@]67[C@](C=8[C@@](C)(C[C@H]6O)[C@@]9(C)[C@](CC8)([C@]%10(C)[C@@](CC9)([C@@](C=O)(C)[C@@H](O[C@H]%11[C@H](O[C@@H]%12O[C@H](CO)[C@H](O)[C@H](O)[C@H]%12O)[C@@H](O[C@H]%13[C@H](O)[C@@H](O)[C@H](O)CO%13)[C@H](O)[C@@H](C(O)=O)O%11)CC%10)[H])[H])(CC(C)(C)CC7)[H]
Synonyms:- (3β,4α,16α)-28-[[O-D-Apio-β-D-furanosyl-(1→3)-O-β-D-xylopyranosyl-(1→4)-O-6-deoxy-α-L-mannopyranosyl-(1→2)-4-O-[5-[[5-(α-L-arabinofuranosyloxy)-3-hydroxy-6-methyl-1-oxooctyl]oxy]-3-hydroxy-6-methyl-1-oxooctyl]-6-deoxy-β-D-galactopyranosyl]oxy]-16-hydroxy-23,28-dioxoolean-12-en-3-yl O-β-D-galactopyranosyl-(1→2)-O-[β-D-xylopyranosyl-(1→3)]-β-D-glucopyranosiduronic acid
- Oleanane, β-D-glucopyranosiduronic acid deriv.
- QS 21
- β-D-Glucopyranosiduronic acid, (3β,4α,16α)-28-[[O-D-apio-β-D-furanosyl-(1→3)-O-β-D-xylopyranosyl-(1→4)-O-6-deoxy-α-L-mannopyranosyl-(1→2)-4-O-[5-[[5-(α-L-arabinofuranosyloxy)-3-hydroxy-6-methyl-1-oxooctyl]oxy]-3-hydroxy-6-methyl-1-oxooctyl]-6-deoxy-β-D-galactopyranosyl]oxy]-16-hydroxy-23,28-dioxoolean-12-en-3-yl O-β-D-galactopyranosyl-(1→2)-O-[β-D-xylopyranosyl-(1→3)]-
- Stimulon
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
QS-21
CAS:<p>QS-21, a saponin adjuvant, boosts Th1/Th2 immunity, interacts with APCs/T cells, and triggers NLRP3 inflammasome releasing IL-1β/IL-18.</p>Formula:C92H148O46Color and Shape:SolidMolecular weight:1990.15QS 21
CAS:<p>QS-21 is a saponin-based adjuvant, which is a compound used to enhance the body's immune response to an antigen. This product is derived from the bark of the Quillaja saponaria tree, commonly known as the soapbark tree, native to Chile. The mode of action of QS-21 involves stimulating the immune system by activating antigen-presenting cells, such as dendritic cells and macrophages, which in turn enhance both humoral and cellular immune responses.</p>Formula:C92H148O46Molecular weight:1,990.14 g/mol

