CAS 141281-38-1

3-METHYL-4-NITROBENZYL BROMIDE 97

Description:

3-Methyl-4-nitrobenzyl bromide is an organic compound characterized by the presence of a bromine atom, a nitro group, and a methyl group attached to a benzene ring. Its molecular structure features a benzyl group, where the benzene ring is substituted with a methyl group at the meta position and a nitro group at the para position relative to the benzyl carbon. This compound is typically a yellow to brown solid and is known for its reactivity, particularly in nucleophilic substitution reactions due to the presence of the bromine atom, which is a good leaving group. It is often used as an intermediate in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. The compound's properties, such as solubility and melting point, can vary based on purity and environmental conditions. Safety precautions should be taken when handling this substance, as it may pose health risks, including irritation to the skin and eyes, and potential toxicity if ingested or inhaled.

Formula: C₈H₈BrNO₂

InChI: InChI=1/C8H8BrNO2/c1-6-4-7(5-9)2-3-8(6)10(11)12/h2-4H,5H2,1H3

SMILES: Cc1cc(ccc1N(=O)=O)CBr

Synonyms:

• 4-(Bromomethyl)-2-Methyl-1-Nitrobenzene
• 3-Methyl-4-nitrobenzyl bromide

3-Methyl-4-nitrobenzyl bromide

CAS: 141281-38-1

Formula: C₈H₈BrNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 230.0586

Ref: IN-DA003JQ5

3-Methyl-4-nitrobenzyl bromide

CAS: 141281-38-1

3-Methyl-4-nitrobenzyl bromide

Formula: C₈H₈BrNO₂

Purity: 98%

Color and Shape: faint yellow solid

Molecular weight: 230.06g/mol

Ref: 54-OR927531

3-Methyl-4-nitrobenzyl bromide

CAS: 141281-38-1

Formula: C₈H₈BrNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 230.061

Ref: 10-F067823