CAS 141318-79-8
:R-3,4-Diaminobutyric acid 2HCl
Description:
R-3,4-Diaminobutyric acid 2HCl, with the CAS number 141318-79-8, is a chemical compound characterized by its structure, which includes two amino groups (-NH2) and a carboxylic acid group (-COOH) attached to a butyric acid backbone. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water, making it useful in various biochemical applications. The presence of multiple amino groups suggests that it may participate in various biochemical interactions, including acting as a building block for peptides or proteins. Its potential applications may extend to areas such as pharmaceuticals, where it could serve as a precursor for drug synthesis or as a research tool in studying amino acid metabolism. Additionally, the compound's basic properties due to the amino groups may influence its behavior in biological systems, including its interaction with enzymes and receptors. Overall, R-3,4-Diaminobutyric acid 2HCl is a versatile compound with significant implications in both research and therapeutic contexts.
Formula:C4H12Cl2N2O2
InChI:InChI=1/C4H10N2O2.2ClH/c5-2-3(6)1-4(7)8;;/h3H,1-2,5-6H2,(H,7,8);2*1H/t3-;;/m1../s1
SMILES:C([C@H](CN)N)C(=O)O.Cl.Cl
Synonyms:- (3R)-3,4-Diaminobutanoic acid dihydrochloride
- butanoic acid, 3,4-diamino-, (3R)-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
