CymitQuimica logo

CAS 141318-80-1

:

S-3,4-Diaminobutyric acid 2HCl

Description:
S-3,4-Diaminobutyric acid 2HCl, with the CAS number 141318-80-1, is a chemical compound characterized by its structure, which includes two amino groups and a carboxylic acid functional group. This compound is a derivative of butyric acid, specifically modified to include amino groups at the 3 and 4 positions, which contributes to its biological activity. The presence of two hydrochloride (HCl) moieties indicates that the compound is in a salt form, enhancing its solubility in water and stability. S-3,4-Diaminobutyric acid is of interest in biochemical research, particularly in studies related to neurotransmitter synthesis and potential therapeutic applications. Its amino groups can participate in various chemical reactions, making it a versatile building block in organic synthesis. Additionally, the compound may exhibit specific physiological effects, which are being explored in pharmacological contexts. Overall, its unique structure and properties make it a subject of interest in both academic and industrial research settings.
Formula:C4H12Cl2N2O2
InChI:InChI=1/C4H10N2O2.2ClH/c5-2-3(6)1-4(7)8;;/h3H,1-2,5-6H2,(H,7,8);2*1H/t3-;;/m0../s1
SMILES:C([C@@H](CN)N)C(=O)O.Cl.Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.