CAS 14132-51-5
:Benzaldehyde-2,3,4,5,6-d5
Description:
Benzaldehyde-2,3,4,5,6-d5 is a deuterated form of benzaldehyde, where five hydrogen atoms in the benzene ring are replaced by deuterium, a stable isotope of hydrogen. This compound retains the characteristic functional group of benzaldehyde, which is the aldehyde (-CHO) group, contributing to its reactivity and properties. The presence of deuterium alters the physical and chemical properties slightly compared to its non-deuterated counterpart, such as changes in boiling point, solubility, and reactivity due to the kinetic isotope effect. Benzaldehyde itself is a colorless liquid with a characteristic almond-like odor and is widely used in organic synthesis, flavoring, and fragrance industries. The deuterated version is particularly valuable in research applications, including NMR spectroscopy and kinetic studies, as it allows for the tracing of molecular pathways and mechanisms in chemical reactions. Overall, Benzaldehyde-2,3,4,5,6-d5 serves as an important tool in both synthetic and analytical chemistry.
Formula:C7HD5O
InChI:InChI=1/C7H6O/c8-6-7-4-2-1-3-5-7/h1-6H/i1D,2D,3D,4D,5D
SMILES:c1(c(c(c(c(c1[2H])[2H])C=O)[2H])[2H])[2H]
Synonyms:- Benzaldehyde-d5
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzaldehyde-2,3,4,5,6-d5
CAS:Formula:C6D5CHOPurity:99 atom % DColor and Shape:Colorless-Pale Yellow Liquid. Burning. Aromatic TasteMolecular weight:111.07325Benzaldehyde D5
CAS:Controlled ProductBenzaldehyde D5 is an odorant that is used in the setup of receptor cells. It has been shown to selectively activate the OR2 receptor, which is responsible for detecting aldehydes. Benzaldehyde D5 has been shown to be more selective than benzaldehyde and benzyl alcohol, which are other odorants that activate this specific receptor. In addition, it has a higher sensitivity than benzoic acid, which activates other receptors. The use of benzaldehyde D5 as a ligand in receptor binding studies can give insight into how different receptors bind odorants and how they are activated by these ligands.Formula:C7HD5OPurity:Min. 95%Molecular weight:111.15 g/mol





