CAS 14132-86-6

4-(4-METHOXY-PHENYL)-4H-[1,2,4]TRIAZOLE-3-THIOL

Description:

4-(4-Methoxy-phenyl)-4H-[1,2,4]triazole-3-thiol, identified by its CAS number 14132-86-6, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a methoxy group (-OCH3) attached to a phenyl ring, enhancing its solubility and reactivity. The presence of a thiol group (-SH) at the 3-position of the triazole ring contributes to its potential as a reducing agent and its ability to form metal complexes. This compound may exhibit biological activity, making it of interest in pharmaceutical and agricultural research. Its unique structural features allow for various applications, including as a ligand in coordination chemistry and as a precursor in organic synthesis. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its practical applications. Overall, 4-(4-methoxy-phenyl)-4H-[1,2,4]triazole-3-thiol is a versatile compound with significant potential in various fields of chemistry.

Formula: C₉H₉N₃OS

InChI: InChI=1/C9H9N3OS/c1-13-8-4-2-7(3-5-8)12-6-10-11-9(12)14/h2-6H,1H3,(H,11,14)

SMILES: COc1ccc(cc1)n1cnnc1S

Synonyms:

• 4-(4-Methoxyphenyl)-4H-1,2,4-triazole-3-thiol
• 4H-1,2,4-triazole-3-thiol, 4-(4-methoxyphenyl)-
• 4-(4-methoxyphenyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione

4-(4-Methoxyphenyl)-4H-1,2,4-triazole-3-thiol

CAS: 14132-86-6

Versatile small molecule scaffold

Formula: C₉H₉N₃OS

Purity: Min. 95%

Molecular weight: 207.25 g/mol

Ref: 3D-PAA13286