CAS 14133-35-8
:methyl-3-amino-3-deoxy-A-D-*mannopyranoside hcl
Description:
Methyl-3-amino-3-deoxy-α-D-mannopyranoside hydrochloride, with the CAS number 14133-35-8, is a derivative of mannose, a simple sugar. This compound features an amino group and a methyl group, which contribute to its unique properties and reactivity. It is typically encountered as a white to off-white crystalline powder, soluble in water and polar solvents, which facilitates its use in various biochemical applications. The presence of the amino group allows for potential interactions in biological systems, making it relevant in studies involving glycosylation and carbohydrate metabolism. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. This compound is primarily utilized in research settings, particularly in the synthesis of glycosylated compounds and in the study of carbohydrate-protein interactions. Its structural characteristics enable it to participate in various chemical reactions, making it a valuable tool in organic synthesis and medicinal chemistry.
Formula:C7H16ClNO5
InChI:InChI=1/C7H15NO5.ClH/c1-12-7-6(11)4(8)5(10)3(2-9)13-7;/h3-7,9-11H,2,8H2,1H3;1H/t3-,4+,5-,6+,7+;/m1./s1
Synonyms:- Methyl 3-Amino-3-Deoxy-a-D-Mannopyranoside, Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl 3-amino-3-deoxy-α-D-mannopyranoside hydrochloride
CAS:<p>Methyl 3-amino-3-deoxy-α-D-mannopyranoside hydrochloride</p>Purity:>98%Molecular weight:229.66g/molMethyl 3-amino-3-deoxy-α-D-mannopyranoside hydrochloride
CAS:<p>Methyl 3-amino-3-deoxy-a-D-mannopyranoside HCl is a potent antioxidant that has been shown to protect cells from lipid peroxidation and protein oxidation. It also inhibits the formation of toxic reactive oxygen species, such as hydroxyl radicals. This compound has been shown to have protection against oxidative stress in cell culture studies. Methyl 3-amino-3-deoxy-a-D-mannopyranoside HCl is an inhibitor of the enzyme catalase, which may be responsible for its antioxidant activity. This compound also inhibits population growth in an aerobic environment, as well as catalase and dismutase activity in a population of bacteria. Methyl 3-amino-3-deoxy-a-D-mannopyranoside HCl is resistant to solanum tuberosum and solanum tuberosum extract and is oxidized by peroxidases found in plants.</p>Formula:C7H15NO5•HClPurity:Min. 95%Color and Shape:PowderMolecular weight:229.66 g/mol


