CAS 141342-71-4

2-[[2-[(Aminoiminomethyl)amino]phenyl]methyl]benzoic acid

Description:

2-[[2-[(Aminoiminomethyl)amino]phenyl]methyl]benzoic acid, with the CAS number 141342-71-4, is a chemical compound characterized by its complex structure, which includes an amino group and a benzoic acid moiety. This compound features multiple functional groups, including an aminoiminomethyl group and a phenyl ring, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the carboxylic acid group. The compound's structure suggests it may participate in hydrogen bonding, influencing its reactivity and interactions with biological targets. Its potential applications could span medicinal chemistry, particularly in the development of pharmaceuticals, given the presence of amino and carboxylic acid functionalities that are often involved in drug-receptor interactions. However, specific properties such as melting point, boiling point, and spectral data would require empirical measurement or detailed literature references for precise characterization.

Formula: C₁₅H₁₅N₃O₂

InChI: InChI=1S/C15H15N3O2/c16-15(17)18-13-8-4-2-6-11(13)9-10-5-1-3-7-12(10)14(19)20/h1-8H,9H2,(H,19,20)(H4,16,17,18)

InChI key: InChIKey=CGAXOGYNLISPHL-UHFFFAOYSA-N

SMILES: C(C1=C(NC(=N)N)C=CC=C1)C2=C(C(O)=O)C=CC=C2

Synonyms:

• 2-[[2-[(Aminoiminomethyl)amino]phenyl]methyl]benzoic acid
• Wal 2003Zw
• Benzoic acid, 2-[[2-[(aminoiminomethyl)amino]phenyl]methyl]-

Epinastine Impurity 1 HCl

CAS: 141342-71-4

Formula: C₁₅H₁₅N₃O₂·HCl

Color and Shape: Off-White Solid

Molecular weight: 269.31 36.46

Ref: 4Z-E-4310

Epinastine Impurity 1

CAS: 141342-71-4

Formula: C₁₅H₁₅N₃O₂

Molecular weight: 269.30

Ref: 4Z-E-4348

Epinastine Hydrochloride I

Controlled Product

CAS: 141342-71-4

Formula: C₁₅H₁₅N₃O₂

Color and Shape: Neat

Molecular weight: 269.298

Ref: TR-E592035