CAS 14135-38-7

2,2'-Difluorodiphenyl disulfide

Description:

2,2'-Difluorodiphenyl disulfide is an organosulfur compound characterized by the presence of two phenyl rings connected by a disulfide (-S-S-) linkage, with two fluorine atoms substituted at the 2-position of each phenyl ring. This compound typically appears as a solid at room temperature and is known for its stability under various conditions. Its molecular structure contributes to its unique chemical properties, including potential reactivity in nucleophilic substitution reactions due to the presence of the disulfide bond. The fluorine substituents can influence the electronic properties of the molecule, potentially enhancing its lipophilicity and altering its interaction with biological systems. 2,2'-Difluorodiphenyl disulfide may be utilized in various applications, including materials science and organic synthesis, particularly in the development of specialty chemicals or as intermediates in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₂H₈F₂S₂

InChI: InChI=1/C12H8F2S2/c13-9-5-1-3-7-11(9)15-16-12-8-4-2-6-10(12)14/h1-8H

SMILES: c1ccc(c(c1)F)SSc1ccccc1F

Synonyms:

• 2,2-Difluoro diphenyl disulfide
• 1,1'-Disulfanediylbis(2-Fluorobenzene)

Disulfide, bis(2-fluorophenyl)

CAS: 14135-38-7

Formula: C₁₂H₈F₂S₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 254.3187

Ref: IN-DA001GA2

2,2'-Difluorodiphenyldisulfide

CAS: 14135-38-7

2,2'-Difluorodiphenyldisulfide

Formula: C₁₂H₈F₂S₂

Purity: 98%

Color and Shape: yellow liquid

Molecular weight: 254.32g/mol

Ref: 54-PC903987