CAS 14135-63-8
:2-Phenyl-3(2H)-pyridazinone
Description:
2-Phenyl-3(2H)-pyridazinone, with the CAS number 14135-63-8, is a heterocyclic organic compound characterized by its pyridazinone core structure, which features a pyridazine ring fused with a carbonyl group and a phenyl substituent. This compound typically exhibits a pale yellow to light brown crystalline appearance. It is known for its potential biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in pharmaceutical research. The presence of the phenyl group enhances its lipophilicity, which can influence its bioavailability and interaction with biological targets. Additionally, 2-Phenyl-3(2H)-pyridazinone may participate in various chemical reactions due to the reactivity of the carbonyl group, allowing for further derivatization. Its solubility can vary depending on the solvent, and it is generally stable under standard laboratory conditions. As with many heterocycles, the compound's properties can be influenced by substituents and the overall molecular environment, making it a versatile candidate for further study in medicinal chemistry and related fields.
Formula:C10H8N2O
InChI:InChI=1/C10H8N2O/c13-10-7-4-8-11-12(10)9-5-2-1-3-6-9/h1-8H
SMILES:c1ccc(cc1)n1c(=O)cccn1
Synonyms:- Ppyz
- 3(2H)-Pyridazinone, 2-phenyl-
- 2-phenylpyridazin-3(2H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-phenyl-2,3-dihydropyridazin-3-one
CAS:Formula:C10H8N2OColor and Shape:SolidMolecular weight:172.18332-Phenyl-2,3-dihydropyridazin-3-one
CAS:2-Phenyl-2,3-dihydropyridazin-3-one is a natural product that has been found in the human liver. It is also an organic solvent that is used in pest control to kill insects and spiders. 2-Phenyl-2,3-dihydropyridazin-3-one is a model system for studying cancer, as it has been shown to induce tumor formation in animals. It is also active against cervical cancer cells at low concentrations and induces apoptosis at high concentrations. This compound can be used as a potential therapeutic agent for the treatment of cancer in humans.
Formula:C10H8N2OPurity:Min. 95%Molecular weight:172.18 g/mol

