CAS 14135-63-8: 2-Phenyl-3(2H)-pyridazinone
Description:2-Phenyl-3(2H)-pyridazinone, with the CAS number 14135-63-8, is a heterocyclic organic compound characterized by its pyridazinone core structure, which features a pyridazine ring fused with a carbonyl group and a phenyl substituent. This compound typically exhibits a pale yellow to light brown crystalline appearance. It is known for its potential biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in pharmaceutical research. The presence of the phenyl group enhances its lipophilicity, which can influence its bioavailability and interaction with biological targets. Additionally, 2-Phenyl-3(2H)-pyridazinone may participate in various chemical reactions due to the reactivity of the carbonyl group, allowing for further derivatization. Its solubility can vary depending on the solvent, and it is generally stable under standard laboratory conditions. As with many heterocycles, the compound's properties can be influenced by substituents and the overall molecular environment, making it a versatile candidate for further study in medicinal chemistry and related fields.
Formula:C10H8N2O
InChI:InChI=1/C10H8N2O/c13-10-7-4-8-11-12(10)9-5-2-1-3-6-9/h1-8H
- Synonyms:
- Ppyz
- 3(2H)-Pyridazinone, 2-phenyl-
- 2-phenylpyridazin-3(2H)-one
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3(2H)-Pyridazinone, 2-phenyl- REF: IN-DA001GA0CAS: 14135-63-8 | - - - | To inquire | Thu 17 Apr 25 |
![]() | 2-Phenyl-2,3-dihydropyridazin-3-one REF: 3D-PAA13563CAS: 14135-63-8 | Min. 95% | To inquire | Thu 29 May 25 |
![]() | 2-Phenylpyridazin-3(2H)-one REF: 10-F769458CAS: 14135-63-8 | 98% | - - - | Discontinued product |

3(2H)-Pyridazinone, 2-phenyl-
Ref: IN-DA001GA0
Undefined size | To inquire |

2-Phenyl-2,3-dihydropyridazin-3-one
Ref: 3D-PAA13563
1g | 1,102.00 € | ||
100mg | 445.00 € |

Ref: 10-F769458
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information |