CAS 141360-89-6

(2β,3β,5β,22R)-2,3,14,20,22-Pentahydroxyergosta-7,24(28)-dien-6-one

Description:

The chemical substance known as (2β,3β,5β,22R)-2,3,14,20,22-Pentahydroxyergosta-7,24(28)-dien-6-one, with the CAS number 141360-89-6, is a steroid derivative characterized by multiple hydroxyl groups and a specific sterol backbone. This compound features a complex structure typical of ergosterol derivatives, which are important in various biological processes, particularly in fungi. The presence of five hydroxyl groups contributes to its hydrophilicity and potential biological activity, influencing its solubility and interaction with biological membranes. The configuration of the stereocenters, particularly the 22R orientation, is crucial for its biological function and activity. This compound may exhibit various pharmacological properties, including antifungal and anti-inflammatory effects, making it of interest in medicinal chemistry and pharmacology. Its unique structural features also suggest potential applications in the development of therapeutic agents or as a biochemical probe in research. Overall, this compound exemplifies the complexity and diversity of steroidal compounds in nature.

Formula: C₂₈H₄₄O₆

InChI: InChI=1S/C28H44O6/c1-15(2)16(3)11-24(32)27(6,33)23-8-10-28(34)18-12-20(29)19-13-21(30)22(31)14-25(19,4)17(18)7-9-26(23,28)5/h12,15,17,19,21-24,30-34H,3,7-11,13-14H2,1-2,4-6H3/t17-,19-,21+,22-,23-,24+,25+,26+,27+,28+/m0/s1

InChI key: InChIKey=OQDKHYZVFZGSRC-DWJOQFFMSA-N

SMILES: O[C@]12C=3[C@@]([C@]4(C)[C@](C(=O)C3)(C[C@@H](O)[C@@H](O)C4)[H])(CC[C@]1(C)[C@@]([C@@]([C@@H](CC(C(C)C)=C)O)(C)O)(CC2)[H])[H]

Synonyms:

• (+)-PolyporusteroneB
• (2β,3β,5β,22R)-2,3,14,20,22-Pentahydroxyergosta-7,24(28)-dien-6-one
• Polyporusterone B
• Ergosta-7,24(28)-dien-6-one, 2,3,14,20,22-pentahydroxy-, (2β,3β,5β,22R)-

Polyporusterone B

CAS: 141360-89-6

Polyporusterone B

Purity: ≥98%

Molecular weight: 476.65g/mol

Ref: 54-BUP00358

Polyporusterone B

CAS: 141360-89-6

Formula: C₂₈H₄₄O₆

Molecular weight: 476.65

Ref: 7W-GY4417

Polyporusterone B

CAS: 141360-89-6

Formula: C₂₈H₄₄O₆

Purity: 95%~99%

Molecular weight: 476.654

Ref: BP-BP4282

Polyporusterone B

CAS: 141360-89-6

Polyporusterone B ((1R,2R,4S,5R,7R,11R,14S,15R)-14-[(2R,3R)-2,3-dihydroxy-6-methyl-5-methylideneheptan-2-yl]-4,5,11-trihydroxy-2,15-dimethyltetracyclo[8.7.0.02

Formula: C₂₈H₄₄O₆

Purity: 98.65%

Color and Shape: Solid

Molecular weight: 476.65

Ref: TM-TN6909

Polyporusterone B

CAS: 141360-89-6

Polyporusterone B is a phytosteroid, which is a natural compound derived from certain species of fungi, specifically those within the Polyporaceae family. This compound is sourced primarily from mushrooms like Polyporus umbellatus, known for its rich presence of bioactive constituents. The mode of action of Polyporusterone B involves its interaction with cellular processes, potentially modulating immune responses and exhibiting antioxidant properties. It is believed to exert these effects through various biochemical pathways, which may influence cell signaling and gene expression.

Formula: C₂₈H₄₄O₆

Purity: Min. 95%

Molecular weight: 476.6 g/mol

Ref: 3D-RFA36089