CymitQuimica logo

CAS 141364-05-8

:

sodium 11-{[2-(4-benzylpiperidin-1-yl)ethyl]sulfanyl}-6,11-dihydrodibenzo[b,e]oxepine-2-carboxylate

Description:
Sodium 11-{[2-(4-benzylpiperidin-1-yl)ethyl]sulfanyl}-6,11-dihydrodibenzo[b,e]oxepine-2-carboxylate is a chemical compound characterized by its complex structure, which includes a dibenzo[b,e]oxepine core, a carboxylate group, and a sulfanyl substituent. This compound features a piperidine moiety, which is known for its role in various pharmacological activities, and a benzyl group that may contribute to its lipophilicity and potential interactions with biological targets. The presence of the sodium ion indicates that it is a salt, which can enhance its solubility in aqueous environments. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Its specific interactions and biological activities would depend on the arrangement of functional groups and the overall three-dimensional conformation. Further studies would be necessary to elucidate its pharmacodynamics, pharmacokinetics, and potential therapeutic uses.
Formula:C29H30NNaO3S
InChI:InChI=1/C29H31NO3S.Na/c31-29(32)23-10-11-27-26(19-23)28(25-9-5-4-8-24(25)20-33-27)34-17-16-30-14-12-22(13-15-30)18-21-6-2-1-3-7-21;/h1-11,19,22,28H,12-18,20H2,(H,31,32);/q;+1/p-1
Synonyms:
  • dibenz[b,e]oxepin-2-carboxylic acid, 6,11-dihydro-11-[[2-[4-(phenylmethyl)-1-piperidinyl]ethyl]thio]-, sodium salt (1:1)
  • KW 4099
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.