CymitQuimica logo

CAS 14143-60-3

:

4-Amino-3,5,6-trichloro-2-pyridinecarbonitrile

Description:
4-Amino-3,5,6-trichloro-2-pyridinecarbonitrile, with the CAS number 14143-60-3, is a chemical compound characterized by its pyridine ring structure, which is substituted with multiple chlorine atoms and an amino group. This compound typically exhibits a pale yellow to light brown solid form and is known for its role as an intermediate in the synthesis of various agrochemicals and pharmaceuticals. The presence of the cyano group (-C≡N) contributes to its reactivity, making it useful in various chemical reactions. Its chlorinated nature enhances its biological activity, which is significant in the development of herbicides and pesticides. The compound's solubility can vary depending on the solvent, and it is generally considered to have moderate stability under standard conditions. Safety data indicates that it should be handled with care due to potential toxicity and environmental impact. Overall, 4-Amino-3,5,6-trichloro-2-pyridinecarbonitrile is an important compound in synthetic organic chemistry with applications in agricultural science.
Formula:C6H2Cl3N3
InChI:InChI=1S/C6H2Cl3N3/c7-3-2(1-10)12-6(9)4(8)5(3)11/h(H2,11,12)
InChI key:InChIKey=AZYYQVGBVUCIEO-UHFFFAOYSA-N
SMILES:C(#N)C1=C(Cl)C(N)=C(Cl)C(Cl)=N1
Synonyms:
  • 2-Pyridinecarbonitrile, 4-amino-3,5,6-trichloro-
  • 4-Amino-3,5,6-trichloropicolinonitrile
  • 4-Amino-3,5,6-trichloro-2-pyridinecarbonitrile
  • Picolinonitrile, 4-amino-3,5,6-trichloro-
  • 4-Amino-3,5,6-trichloro-2-cyanopyridine
Found 2 products.