CAS 141437-85-6
:(S)-2-BENZYL-2-N-BOCAMINO-ETHYL THIOL
Description:
(S)-2-Benzyl-2-N-bocamino-ethyl thiol, with the CAS number 141437-85-6, is an organic compound characterized by the presence of a thiol functional group (-SH) attached to a carbon chain that includes a benzyl group and a tert-butoxycarbonyl (Boc) protected amine. This compound typically exhibits properties associated with thiols, such as a strong, often unpleasant odor, and is known for its reactivity, particularly in nucleophilic substitution reactions. The Boc group serves as a protective group for the amine, allowing for selective reactions without interfering with the thiol functionality. The stereochemistry indicated by the (S) designation suggests that the compound has a specific spatial arrangement, which can influence its biological activity and reactivity. Such compounds are often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to their ability to participate in various chemical transformations. Safety considerations should be taken into account when handling thiols, as they can be toxic and have strong odors.
Formula:C14H21NO2S
InChI:InChI=1/C14H21NO2S/c1-14(2,3)17-13(16)15-12(10-18)9-11-7-5-4-6-8-11/h4-8,12,18H,9-10H2,1-3H3,(H,15,16)/t12-/m0/s1
SMILES:CC(C)(C)OC(=N[C@@H](Cc1ccccc1)CS)O
Synonyms:- Carbamic acid, N-[(1S)-2-mercapto-1-(phenylmethyl)ethyl]-, 1,1-dimethylethyl ester
- tert-Butyl [(2S)-1-phenyl-3-sulfanylpropan-2-yl]carbamate
- tert-butyl N-[(1S)-1-benzyl-2-sulfanyl-ethyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
