
CAS 1414513-73-7
:3-(Dimethylamino)-3-oxetanecarbonitrile
Description:
3-(Dimethylamino)-3-oxetanecarbonitrile is a chemical compound characterized by its unique structure, which includes a five-membered oxetane ring and a cyano group. The presence of the dimethylamino group contributes to its basicity and potential reactivity, making it an interesting candidate for various chemical reactions, particularly in organic synthesis. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where the oxetane ring can serve as a versatile building block. Additionally, the cyano group may enhance its reactivity, allowing for further functionalization. Safety data should be consulted, as compounds with similar structures can exhibit toxicity or environmental hazards. Overall, 3-(Dimethylamino)-3-oxetanecarbonitrile represents a valuable compound in the realm of synthetic organic chemistry, with properties that warrant further exploration for practical applications.
Formula:C6H10N2O
InChI:InChI=1S/C6H10N2O/c1-8(2)6(3-7)4-9-5-6/h4-5H2,1-2H3
InChI key:InChIKey=NJGQPBXFQSJJTO-UHFFFAOYSA-N
SMILES:N(C)(C)C1(C#N)COC1
Synonyms:- 3-Oxetanecarbonitrile, 3-(dimethylamino)-
- 3-(Dimethylamino)-3-oxetanecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.