CAS 141452-01-9

methyl indoline-5-carboxylate

Description:

Methyl indoline-5-carboxylate is an organic compound characterized by its indoline structure, which features a fused benzene and pyrrole ring system. This compound typically exhibits a carboxylate functional group, which contributes to its reactivity and solubility in various solvents. Methyl indoline-5-carboxylate is often used in organic synthesis and medicinal chemistry due to its potential biological activity and ability to serve as a building block for more complex molecules. The presence of the methyl ester group enhances its lipophilicity, making it more soluble in organic solvents compared to its carboxylic acid counterpart. Additionally, the compound may exhibit fluorescence properties, which can be advantageous in certain applications, such as in the development of fluorescent probes or dyes. Its structural features suggest potential interactions with biological targets, making it a subject of interest in drug discovery and development. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₁₀H₁₁NO₂

InChI: InChI=1/C10H11NO2/c1-13-10(12)8-2-3-9-7(6-8)4-5-11-9/h2-3,6,11H,4-5H2,1H3

SMILES: COC(=O)c1ccc2c(CCN2)c1

Synonyms:

• 1H-indole-5-carboxylic acid, 2,3-dihydro-, methyl ester
• methyl 2,3-dihydro-1H-indole-5-carboxylate
• Methyl indoline-5-carboxylate

1H-Indole-5-carboxylic acid, 2,3-dihydro-, methyl ester

CAS: 141452-01-9

Formula: C₁₀H₁₁NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 177.1998

Ref: IN-DA001GEI

Methyl indoline-5-carboxylate

CAS: 141452-01-9

Methyl indoline-5-carboxylate

Formula: C₁₀H₁₁NO₂

Purity: 98%

Color and Shape: pale yellow solid

Molecular weight: 177.20g/mol

Ref: 54-OR900065

Methyl indoline-5-carboxylate

CAS: 141452-01-9

Formula: C₁₀H₁₁NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 177.203

Ref: 10-F077336

Methyl indoline-5-carboxylate

Controlled Product

CAS: 141452-01-9

Applications Methyl indoline-5-carboxylate

Formula: C₁₀H₁₁NO₂

Color and Shape: Neat

Molecular weight: 177.2

Ref: TR-M313618