CAS 141452-01-9
:methyl indoline-5-carboxylate
Description:
Methyl indoline-5-carboxylate is an organic compound characterized by its indoline structure, which features a fused benzene and pyrrole ring system. This compound typically exhibits a carboxylate functional group, which contributes to its reactivity and solubility in various solvents. Methyl indoline-5-carboxylate is often used in organic synthesis and medicinal chemistry due to its potential biological activity and ability to serve as a building block for more complex molecules. The presence of the methyl ester group enhances its lipophilicity, making it more soluble in organic solvents compared to its carboxylic acid counterpart. Additionally, the compound may exhibit fluorescence properties, which can be advantageous in certain applications, such as in the development of fluorescent probes or dyes. Its structural features suggest potential interactions with biological targets, making it a subject of interest in drug discovery and development. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C10H11NO2
InChI:InChI=1/C10H11NO2/c1-13-10(12)8-2-3-9-7(6-8)4-5-11-9/h2-3,6,11H,4-5H2,1H3
SMILES:COC(=O)c1ccc2c(CCN2)c1
Synonyms:- 1H-indole-5-carboxylic acid, 2,3-dihydro-, methyl ester
- methyl 2,3-dihydro-1H-indole-5-carboxylate
- Methyl indoline-5-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl indoline-5-carboxylate
CAS:Methyl indoline-5-carboxylateFormula:C10H11NO2Purity:98%Color and Shape:SolidMolecular weight:177.199841H-Indole-5-carboxylic acid, 2,3-dihydro-, methyl ester
CAS:Formula:C10H11NO2Purity:95%Color and Shape:SolidMolecular weight:177.1998Ref: IN-DA001GEI
50gTo inquire100gTo inquire100mg31.00€250mg43.00€1g62.00€500mg68.00€5g140.00€10g183.00€25g354.00€Methyl indoline-5-carboxylate
CAS:Methyl indoline-5-carboxylateFormula:C10H11NO2Purity:98%Molecular weight:177.2Methyl indoline-5-carboxylate
CAS:Formula:C10H11NO2Purity:95%Color and Shape:SolidMolecular weight:177.203Methyl indoline-5-carboxylate
CAS:Controlled ProductApplications Methyl indoline-5-carboxylate
Formula:C10H11NO2Color and Shape:NeatMolecular weight:177.2




