CAS 1414642-52-6

1,1-Dimethylethyl N-[2-[(2,2-difluoroethyl)amino]-2-oxoethyl]carbamate

Description:

1,1-Dimethylethyl N-[2-[(2,2-difluoroethyl)amino]-2-oxoethyl]carbamate, identified by its CAS number 1414642-52-6, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by the presence of a dimethyl group, which contributes to its steric properties, and a difluoroethyl group that enhances its reactivity and potential biological activity. The compound is likely to exhibit moderate to high polarity due to the presence of functional groups such as the carbamate and amino moieties. Its unique structure suggests potential applications in pharmaceuticals or agrochemicals, particularly in the development of compounds with specific biological activities. Additionally, the presence of fluorine atoms may impart unique electronic properties, influencing its interaction with biological targets. Safety and handling considerations are essential, as with many synthetic organic compounds, due to potential toxicity or environmental impact. Further studies would be necessary to fully elucidate its properties and applications.

Formula: C₉H₁₆F₂N₂O₃

InChI: InChI=1S/C9H16F2N2O3/c1-9(2,3)16-8(15)13-5-7(14)12-4-6(10)11/h6H,4-5H2,1-3H3,(H,12,14)(H,13,15)

InChI key: InChIKey=RKCZMAQVHULBEG-UHFFFAOYSA-N

SMILES: C(NCC(NCC(F)F)=O)(OC(C)(C)C)=O

Synonyms:

• 1,1-Dimethylethyl N-[2-[(2,2-difluoroethyl)amino]-2-oxoethyl]carbamate
• Carbamic acid, N-[2-[(2,2-difluoroethyl)amino]-2-oxoethyl]-, 1,1-dimethylethyl ester
• [(2,2-Difluoro-ethylcarbamoyl)-methyl]-carbamic acid tert-butyl ester

tert-Butyl N-{[(2,2-difluoroethyl)carbamoyl]methyl}carbamate

CAS: 1414642-52-6

Versatile small molecule scaffold

Formula: C₉H₁₆F₂N₂O₃

Purity: Min. 95%

Molecular weight: 238.23 g/mol

Ref: 3D-PGC64252