CymitQuimica logo

CAS 141474-37-5

:

2,4-dibromo-6-fluoroaniline

Description:
2,4-Dibromo-6-fluoroaniline is an organic compound characterized by the presence of two bromine atoms and one fluorine atom attached to a benzene ring that also contains an amino group (-NH2). This compound belongs to the class of anilines, which are aromatic amines. Its molecular structure contributes to its unique chemical properties, including its reactivity and potential applications in various fields such as pharmaceuticals and agrochemicals. The presence of halogen substituents (bromine and fluorine) can significantly influence the compound's electronic properties, making it a useful intermediate in organic synthesis. Additionally, the amino group can participate in hydrogen bonding, affecting the compound's solubility and interaction with other molecules. 2,4-Dibromo-6-fluoroaniline is typically handled with care due to the potential toxicity associated with halogenated compounds and amines. Its specific applications and behavior in chemical reactions can vary based on the conditions and the presence of other reactants.
Formula:C6H4Br2FN
InChI:InChI=1S/C6H4Br2FN/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2
InChI key:InChIKey=YJLXEKFYZIBUPJ-UHFFFAOYSA-N
SMILES:NC1=C(Br)C=C(Br)C=C1F
Synonyms:
  • 2,4-Dibromo-6-fluorophenylamine
  • 2,4-Dibromo-6-fluorobenzenamine
  • 2,4-Dibromo-6-fluoroaniline
  • Benzenamine, 2,4-dibromo-6-fluoro-
  • 2-Fluoro-4,6-dibromoaniline
Found 5 products.