CymitQuimica logo

CAS 14148-42-6

:

8-hydrazinylquinoline hydrochloride

Description:
8-Hydrazinylquinoline hydrochloride is a chemical compound characterized by its hydrazine and quinoline moieties, which contribute to its unique properties. It typically appears as a crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. This compound is of interest in various fields, including medicinal chemistry, where it may exhibit biological activity, particularly as an antitumor or antimicrobial agent. The hydrazinyl group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the quinoline structure is known for its ability to chelate metal ions, which can enhance its reactivity and potential applications in coordination chemistry. Safety data indicates that, like many hydrazine derivatives, it should be handled with care due to potential toxicity and reactivity. Overall, 8-hydrazinylquinoline hydrochloride is a compound with significant potential in research and development, particularly in the synthesis of novel pharmaceuticals and agrochemicals.
Formula:C9H9N3
InChI:InChI=1S/C9H9N3/c10-12-8-5-1-3-7-4-2-6-11-9(7)8/h1-6,12H,10H2
InChI key:HJJRRHBSMQOZQH-UHFFFAOYSA-N
SMILES:C1=CC2=C(C(=C1)NN)N=CC=C2
Found 2 products.