CAS 1414864-12-2
:3-Iodo-2,5,6-trimethoxy-4-pyridinol
Description:
3-Iodo-2,5,6-trimethoxy-4-pyridinol is a chemical compound characterized by its pyridine ring, which is substituted with three methoxy groups and an iodine atom. The presence of the methoxy groups contributes to its solubility and reactivity, while the iodine atom can enhance its biological activity and potential as a pharmacophore. This compound is likely to exhibit properties typical of pyridine derivatives, such as basicity and the ability to participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The methoxy groups can also influence the electronic properties of the molecule, potentially affecting its interaction with biological targets. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can modulate biological activity. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used or studied.
Formula:C8H10INO4
InChI:InChI=1S/C8H10INO4/c1-12-6-5(11)4(9)7(13-2)10-8(6)14-3/h1-3H3,(H,10,11)
InChI key:InChIKey=LPTOQUNCESDUOB-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)N=C(OC)C(I)=C1O
Synonyms:- 3-Iodo-2,5,6-trimethoxy-4-pyridinol
- 4-Pyridinol, 3-iodo-2,5,6-trimethoxy-
- 3-Iodo-2,5,6-trimethoxypyridin-4-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.