CAS 1414870-51-1

4-[(2-Bromo-5-methylphenyl)methyl]morpholine

Description:

4-[(2-Bromo-5-methylphenyl)methyl]morpholine is an organic compound characterized by its morpholine ring, which is a six-membered heterocyclic structure containing one nitrogen atom. The presence of a bromo substituent on the aromatic ring contributes to its reactivity and potential applications in organic synthesis. The methyl group on the phenyl ring enhances the compound's lipophilicity, which can influence its biological activity and solubility in organic solvents. This compound may exhibit properties typical of morpholine derivatives, such as being a potential intermediate in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the presence of the bromine atom may provide opportunities for further functionalization. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity and reactivity. Overall, 4-[(2-Bromo-5-methylphenyl)methyl]morpholine represents a versatile building block in synthetic organic chemistry.

Formula: C₁₂H₁₆BrNO

InChI: InChI=1S/C12H16BrNO/c1-10-2-3-12(13)11(8-10)9-14-4-6-15-7-5-14/h2-3,8H,4-7,9H2,1H3

InChI key: InChIKey=OVQDUVODQKWVQI-UHFFFAOYSA-N

SMILES: C(C1=C(Br)C=CC(C)=C1)N2CCOCC2

Synonyms:

• Morpholine, 4-[(2-bromo-5-methylphenyl)methyl]-
• 4-[(2-Bromo-5-methylphenyl)methyl]morpholine

Morpholine, 4-[(2-bromo-5-methylphenyl)methyl]-

CAS: 1414870-51-1

Formula: C₁₂H₁₆BrNO

Purity: 97%

Molecular weight: 270.1655

Ref: IN-DA01SER7

4-[(2-Bromo-5-methylphenyl)methyl]-morpholine

CAS: 1414870-51-1

Purity: ≥95%

Molecular weight: 270.1700134

Ref: 10-F632222