CAS 1414870-58-8

6-Methyl-4′-(trifluoromethyl)[1,1′-biphenyl]-3-amine

Description:

6-Methyl-4′-(trifluoromethyl)[1,1′-biphenyl]-3-amine, with the CAS number 1414870-58-8, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methyl group at the 6-position and a trifluoromethyl group at the 4′-position contributes to its unique chemical properties, including increased lipophilicity and potential for specific interactions in biological systems. The amine functional group at the 3-position introduces basicity and reactivity, making it a candidate for various chemical reactions, such as nucleophilic substitutions. This compound may exhibit interesting pharmacological properties due to its structural features, which can influence its binding affinity to biological targets. Additionally, the trifluoromethyl group is known to enhance metabolic stability and lipophilicity, often leading to improved bioavailability in medicinal chemistry applications. Overall, this compound's unique combination of functional groups and structural characteristics makes it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₄H₁₂F₃N

InChI: InChI=1S/C14H12F3N/c1-9-2-7-12(18)8-13(9)10-3-5-11(6-4-10)14(15,16)17/h2-8H,18H2,1H3

InChI key: InChIKey=YBKNKLBAXGCZDR-UHFFFAOYSA-N

SMILES: CC1=C(C=C(N)C=C1)C2=CC=C(C(F)(F)F)C=C2

Synonyms:

• 6-Methyl-4′-(trifluoromethyl)[1,1′-biphenyl]-3-amine
• [1,1′-Biphenyl]-3-amine, 6-methyl-4′-(trifluoromethyl)-

[1,1′-Biphenyl]-3-amine, 6-methyl-4′-(trifluoromethyl)-

CAS: 1414870-58-8

Formula: C₁₄H₁₂F₃N

Purity: 98%

Molecular weight: 251.2470

Ref: IN-DA01K6Z8

4-Methyl-3-[4-(trifluoromethyl)phenyl]aniline

CAS: 1414870-58-8

Purity: ≥95%

Molecular weight: 251.2519989

Ref: 10-F632160