CAS 14149-31-6
:3-Phenylglutarimide
Description:
3-Phenylglutarimide is an organic compound characterized by its imide functional group and a phenyl substituent on the third carbon of the glutarimide backbone. It typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. The compound features a five-membered cyclic structure that includes two carbonyl groups, contributing to its chemical reactivity and potential applications in organic synthesis. 3-Phenylglutarimide can be synthesized through various methods, often involving the reaction of glutaric anhydride with phenylamine. It is of interest in medicinal chemistry and materials science due to its potential biological activities and utility as a building block in the synthesis of more complex molecules. Safety data indicates that, like many organic compounds, it should be handled with care, using appropriate personal protective equipment to avoid inhalation or skin contact. Overall, 3-Phenylglutarimide serves as a valuable compound in both research and industrial applications.
Formula:C11H11NO2
InChI:InChI=1/C11H11NO2/c13-10-6-9(7-11(14)12-10)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,12,13,14)
InChI key:InChIKey=LIEGIQPEUGHGAI-UHFFFAOYSA-N
SMILES:O=C1CC(CC(=O)N1)C2=CC=CC=C2
Synonyms:- 2,6-Piperidinedione, 4-Phenyl-
- 3-Phenylglutarimide
- 4-Phenyl-2,6-piperidinedione
- Glutarimide, 3-phenyl-
- NSC 522104
- β-Phenylglutarimide
- 4-Phenylpiperidine-2,6-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Phenylpiperidine-2,6-dione
CAS:Formula:C11H11NO2Purity:95%Color and Shape:SolidMolecular weight:189.21054-PHENYLPIPERIDINE-2,6-DIONE
CAS:Formula:C11H11NO2Purity:97.0%Color and Shape:SolidMolecular weight:189.2144-Phenylpiperidine-2,6-dione
CAS:4-Phenylpiperidine-2,6-dione is a pharmacological agent that binds to the lipoprotein receptor, which is found on the surface of cells. It has been shown to reduce serum lipid levels in animals by decreasing the synthesis of cholesterol and triglycerides. 4-Phenylpiperidine-2,6-dione has also been shown to inhibit the activity of chylomicrons and very low density lipoproteins (VLDL) by reducing their production or increasing their catabolism. The affinity of 4-phenylpiperidine-2,6-dione for chylomicrons and VLDLs can be measured using assay methods such as ELISA or Western blot analysis.Formula:C11H11NO2Purity:Min. 95%Molecular weight:189.21 g/mol


