CAS 14149-32-7

4-methyl-4-phenylpiperidine-2,6-dione

Description:

4-Methyl-4-phenylpiperidine-2,6-dione, with the CAS number 14149-32-7, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a methyl group and a phenyl group attached to the piperidine ring, contributing to its unique properties. It is classified as a diketone due to the presence of two carbonyl (C=O) groups located at the 2 and 6 positions of the piperidine ring. The presence of these functional groups imparts reactivity typical of diketones, such as the ability to undergo condensation reactions. The compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Overall, 4-methyl-4-phenylpiperidine-2,6-dione is a notable compound in organic synthesis and potential therapeutic applications.

Formula: C₁₂H₁₃NO₂

InChI: InChI=1/C12H13NO2/c1-12(9-5-3-2-4-6-9)7-10(14)13-11(15)8-12/h2-6H,7-8H2,1H3,(H,13,14,15)

SMILES: CC1(CC(=NC(=O)C1)O)c1ccccc1

4-Methyl-4-phenylpiperidine-2,6-dione

CAS: 14149-32-7

Versatile small molecule scaffold

Formula: C₁₂H₁₃NO₂

Purity: Min. 95%

Molecular weight: 203.24 g/mol

Ref: 3D-PAA14932